C9H20N2 — CID 12546533
(E)-N,N,N',N',2-pentamethylbut-2-ene-1,4-diamine (PubChem CID 12546533) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is (E)-N,N,N',N',2-pentamethylbut-2-ene-1,4-diamine.
| Compound Name | (E)-N,N,N',N',2-pentamethylbut-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 12546533 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (E)-N,N,N',N',2-pentamethylbut-2-ene-1,4-diamine |
| SMILES | C/C(=C\CN(C)C)CN(C)C |
| InChI | InChI=1S/C9H20N2/c1-9(8-11(4)5)6-7-10(2)3/h6H,7-8H2,1-5H3/b9-6+ |
| InChIKey | UUQPYCFZHDDSJZ-RMKNXTFCSA-N |
| XLogP | 1.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|