C18H20N2O8S2 — CID 125465470
1-[(1R,4R)-1,4-bis(methylsulfonyl)-4-(4-nitrophenyl)butyl]-4-nitrobenzene (PubChem CID 125465470) has the molecular formula C18H20N2O8S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is 1-[(1R,4R)-1,4-bis(methylsulfonyl)-4-(4-nitrophenyl)butyl]-4-nitrobenzene.
| Compound Name | 1-[(1R,4R)-1,4-bis(methylsulfonyl)-4-(4-nitrophenyl)butyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 125465470 |
| Molecular Formula | C18H20N2O8S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-[(1R,4R)-1,4-bis(methylsulfonyl)-4-(4-nitrophenyl)butyl]-4-nitrobenzene |
| SMILES | CS(=O)(=O)[C@H](CC[C@H](c1ccc([N+](=O)[O-])cc1)S(C)(=O)=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N2O8S2/c1-29(25,26)17(13-3-7-15(8-4-13)19(21)22)11-12-18(30(2,27)28)14-5-9-16(10-6-14)20(23)24/h3-10,17-18H,11-12H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | RNHARNJGVSMCIW-QZTJIDSGSA-N |
| XLogP | 3.15 |
| TPSA | 154.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|