C8H11Cl3O2 — CID 12546554
2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylic acid (PubChem CID 12546554) has the molecular formula C8H11Cl3O2 and a molecular weight of 245.53 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 12546554 |
| Molecular Formula | C8H11Cl3O2 |
| Molecular Weight | 245.53 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(CC(Cl)(Cl)Cl)C1C(=O)O |
| InChI | InChI=1S/C8H11Cl3O2/c1-7(2)4(3-8(9,10)11)5(7)6(12)13/h4-5H,3H2,1-2H3,(H,12,13) |
| InChIKey | NZWWZHKTQANWRM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|