C12H6Cl3N3O2S — CID 1254656
1-(2,3,4-trichlorophenyl)sulfonylbenzotriazole (PubChem CID 1254656) has the molecular formula C12H6Cl3N3O2S and a molecular weight of 362.63 g/mol. Its IUPAC name is 1-(2,3,4-trichlorophenyl)sulfonylbenzotriazole.
| Compound Name | 1-(2,3,4-trichlorophenyl)sulfonylbenzotriazole |
|---|---|
| PubChem CID | 1254656 |
| Molecular Formula | C12H6Cl3N3O2S |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 360.92 |
| IUPAC Name | 1-(2,3,4-trichlorophenyl)sulfonylbenzotriazole |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1Cl)n1nnc2ccccc21 |
| InChI | InChI=1S/C12H6Cl3N3O2S/c13-7-5-6-10(12(15)11(7)14)21(19,20)18-9-4-2-1-3-8(9)16-17-18/h1-6H |
| InChIKey | NDUPJUJSLQFXMC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|