About (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide
(2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide (PubChem CID 125465615) has the molecular formula C18H22F2N2O2Si
and a molecular weight of 364.47 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide |
| PubChem CID | 125465615 |
| Molecular Formula | C18H22F2N2O2Si |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc([C@H](N)C(=O)Nc2cc(F)c([Si](C)(C)C)cc2F)cc1 |
| InChI | InChI=1S/C18H22F2N2O2Si/c1-24-12-7-5-11(6-8-12)17(21)18(23)22-15-9-14(20)16(10-13(15)19)25(2,3)4/h5-10,17H,21H2,1-4H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | BFTBCSSQJVPZOE-KRWDZBQOSA-N |
| XLogP | 3.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide?
The IUPAC name of (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide (CID 125465615) is (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide.
What is the SMILES notation for (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide?
The canonical SMILES for (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide is COc1ccc([C@H](N)C(=O)Nc2cc(F)c([Si](C)(C)C)cc2F)cc1.
What is the InChIKey of (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide?
The InChIKey is BFTBCSSQJVPZOE-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H22F2N2O2Si/c1-24-12-7-5-11(6-8-12)17(21)18(23)22-15-9-14(20)16(10-13(15)19)25(2,3)4/h5-10,17H,21H2,1-4H3,(H,22,23)/t17-/m0/s1.
What are the key properties of (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide?
(2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide has a molecular weight of 364.47 g/mol, XLogP of 3.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-(2,5-difluoro-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide is sourced from PubChem (CID 125465615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).