C18H29N — CID 125466458
N-[(2R)-2-cyclohexyl-2-phenylethyl]butan-1-amine (PubChem CID 125466458) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is N-[(2R)-2-cyclohexyl-2-phenylethyl]butan-1-amine.
| Compound Name | N-[(2R)-2-cyclohexyl-2-phenylethyl]butan-1-amine |
|---|---|
| PubChem CID | 125466458 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-[(2R)-2-cyclohexyl-2-phenylethyl]butan-1-amine |
| SMILES | CCCCNC[C@@H](c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H29N/c1-2-3-14-19-15-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4,6-7,10-11,17-19H,2-3,5,8-9,12-15H2,1H3/t18-/m0/s1 |
| InChIKey | SCSCQNIVXIKVGA-SFHVURJKSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|