C17H14BrF3O2 — CID 125467495
(3S)-3-[2-bromo-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)propanoic acid (PubChem CID 125467495) has the molecular formula C17H14BrF3O2 and a molecular weight of 387.20 g/mol. Its IUPAC name is (3S)-3-[2-bromo-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)propanoic acid.
| Compound Name | (3S)-3-[2-bromo-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 125467495 |
| Molecular Formula | C17H14BrF3O2 |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | (3S)-3-[2-bromo-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc([C@H](CC(=O)O)c2ccc(C(F)(F)F)cc2Br)cc1 |
| InChI | InChI=1S/C17H14BrF3O2/c1-10-2-4-11(5-3-10)14(9-16(22)23)13-7-6-12(8-15(13)18)17(19,20)21/h2-8,14H,9H2,1H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | LPMJTZOIGDLSAX-AWEZNQCLSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |