C9H7F5N2O — CID 12546887
2-amino-N-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 12546887) has the molecular formula C9H7F5N2O and a molecular weight of 254.16 g/mol. Its IUPAC name is 2-amino-N-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | 2-amino-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 12546887 |
| Molecular Formula | C9H7F5N2O |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-amino-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | CC(N)C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H7F5N2O/c1-2(15)9(17)16-8-6(13)4(11)3(10)5(12)7(8)14/h2H,15H2,1H3,(H,16,17) |
| InChIKey | GNDYJMTVMSTISY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|