About 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride
3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride (PubChem CID 125469253) has the molecular formula C12H13ClOS
and a molecular weight of 240.75 g/mol. Its IUPAC name is 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride.
Molecular Properties
| Compound Name | 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride |
| PubChem CID | 125469253 |
| Molecular Formula | C12H13ClOS |
| Molecular Weight | 240.75 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride |
| SMILES | Cc1ccc(C(=O)Cl)c(C)c1SC1CC1 |
| InChI | InChI=1S/C12H13ClOS/c1-7-3-6-10(12(13)14)8(2)11(7)15-9-4-5-9/h3,6,9H,4-5H2,1-2H3 |
| InChIKey | IUIHCSABBIHKHV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride?
The IUPAC name of 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride (CID 125469253) is 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride.
What is the SMILES notation for 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride?
The canonical SMILES for 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride is Cc1ccc(C(=O)Cl)c(C)c1SC1CC1.
What is the InChIKey of 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride?
The InChIKey is IUIHCSABBIHKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClOS/c1-7-3-6-10(12(13)14)8(2)11(7)15-9-4-5-9/h3,6,9H,4-5H2,1-2H3.
What are the key properties of 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride?
3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride has a molecular weight of 240.75 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylsulfanyl-2,4-dimethylbenzoyl chloride is sourced from PubChem (CID 125469253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).