About (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine
(7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine (PubChem CID 125469550) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine.
Molecular Properties
| Compound Name | (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine |
| PubChem CID | 125469550 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine |
| SMILES | C[C@@H]1Cc2c(N)cccc21 |
| InChI | InChI=1S/C9H11N/c1-6-5-8-7(6)3-2-4-9(8)10/h2-4,6H,5,10H2,1H3/t6-/m1/s1 |
| InChIKey | RJBWLJBIDFATGN-ZCFIWIBFSA-N |
| XLogP | 1.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine?
The IUPAC name of (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine (CID 125469550) is (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine.
What is the SMILES notation for (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine?
The canonical SMILES for (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine is C[C@@H]1Cc2c(N)cccc21.
What is the InChIKey of (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine?
The InChIKey is RJBWLJBIDFATGN-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H11N/c1-6-5-8-7(6)3-2-4-9(8)10/h2-4,6H,5,10H2,1H3/t6-/m1/s1.
What are the key properties of (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine?
(7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine has a molecular weight of 133.19 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine is sourced from PubChem (CID 125469550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).