C9H11N — CID 125469550
(7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine (PubChem CID 125469550) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine.
| Compound Name | (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine |
|---|---|
| PubChem CID | 125469550 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (7R)-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine |
| SMILES | C[C@@H]1Cc2c(N)cccc21 |
| InChI | InChI=1S/C9H11N/c1-6-5-8-7(6)3-2-4-9(8)10/h2-4,6H,5,10H2,1H3/t6-/m1/s1 |
| InChIKey | RJBWLJBIDFATGN-ZCFIWIBFSA-N |
| XLogP | 1.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|