About [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid
[(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid (PubChem CID 125469637) has the molecular formula C10H16BNO3
and a molecular weight of 209.05 g/mol. Its IUPAC name is [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid.
Molecular Properties
| Compound Name | [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid |
| PubChem CID | 125469637 |
| Molecular Formula | C10H16BNO3 |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid |
| SMILES | CC(C)[C@](O)(/C=C/B(O)O)C1(C#N)CC1 |
| InChI | InChI=1S/C10H16BNO3/c1-8(2)10(13,5-6-11(14)15)9(7-12)3-4-9/h5-6,8,13-15H,3-4H2,1-2H3/b6-5+/t10-/m1/s1 |
| InChIKey | ATBUSINMPSATDS-BRAIEQGRSA-N |
| XLogP | 0.25 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid?
The IUPAC name of [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid (CID 125469637) is [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid.
What is the SMILES notation for [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid?
The canonical SMILES for [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid is CC(C)[C@](O)(/C=C/B(O)O)C1(C#N)CC1.
What is the InChIKey of [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid?
The InChIKey is ATBUSINMPSATDS-BRAIEQGRSA-N. The full InChI is InChI=1S/C10H16BNO3/c1-8(2)10(13,5-6-11(14)15)9(7-12)3-4-9/h5-6,8,13-15H,3-4H2,1-2H3/b6-5+/t10-/m1/s1.
What are the key properties of [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid?
[(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid has a molecular weight of 209.05 g/mol, XLogP of 0.25, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,3S)-3-(1-cyanocyclopropyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid is sourced from PubChem (CID 125469637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).