C15H15BN2O4 — CID 125469685
[4-[(4-cyclopropyloxy-2-pyridinyl)carbamoyl]phenyl]boronic acid (PubChem CID 125469685) has the molecular formula C15H15BN2O4 and a molecular weight of 298.11 g/mol. Its IUPAC name is [4-[(4-cyclopropyloxy-2-pyridinyl)carbamoyl]phenyl]boronic acid.
| Compound Name | [4-[(4-cyclopropyloxy-2-pyridinyl)carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 125469685 |
| Molecular Formula | C15H15BN2O4 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [4-[(4-cyclopropyloxy-2-pyridinyl)carbamoyl]phenyl]boronic acid |
| SMILES | O=C(Nc1cc(OC2CC2)ccn1)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C15H15BN2O4/c19-15(10-1-3-11(4-2-10)16(20)21)18-14-9-13(7-8-17-14)22-12-5-6-12/h1-4,7-9,12,20-21H,5-6H2,(H,17,18,19) |
| InChIKey | LJAZXAUGCLTSNH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|