About [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid
[(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid (PubChem CID 125469789) has the molecular formula C9H14BNO3
and a molecular weight of 195.03 g/mol. Its IUPAC name is [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid.
Molecular Properties
| Compound Name | [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid |
| PubChem CID | 125469789 |
| Molecular Formula | C9H14BNO3 |
| Molecular Weight | 195.03 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid |
| SMILES | C[C@](O)(/C=C/B(O)O)C1(C#N)CCC1 |
| InChI | InChI=1S/C9H14BNO3/c1-8(12,5-6-10(13)14)9(7-11)3-2-4-9/h5-6,12-14H,2-4H2,1H3/b6-5+/t8-/m0/s1 |
| InChIKey | RDNKNVUTHKVVSJ-GJIOHYHPSA-N |
| XLogP | -0.00 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.03 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid?
The IUPAC name of [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid (CID 125469789) is [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid.
What is the SMILES notation for [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid?
The canonical SMILES for [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid is C[C@](O)(/C=C/B(O)O)C1(C#N)CCC1.
What is the InChIKey of [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid?
The InChIKey is RDNKNVUTHKVVSJ-GJIOHYHPSA-N. The full InChI is InChI=1S/C9H14BNO3/c1-8(12,5-6-10(13)14)9(7-11)3-2-4-9/h5-6,12-14H,2-4H2,1H3/b6-5+/t8-/m0/s1.
What are the key properties of [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid?
[(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid has a molecular weight of 195.03 g/mol, XLogP of -0.00, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxybut-1-enyl]boronic acid is sourced from PubChem (CID 125469789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).