About 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile
2-[(1S,3S)-3-aminocyclohexyl]acetonitrile (PubChem CID 125469996) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile |
| PubChem CID | 125469996 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile |
| SMILES | N#CC[C@H]1CCC[C@H](N)C1 |
| InChI | InChI=1S/C8H14N2/c9-5-4-7-2-1-3-8(10)6-7/h7-8H,1-4,6,10H2/t7-,8+/m1/s1 |
| InChIKey | LORJPTZKJDDDFO-SFYZADRCSA-N |
| XLogP | 1.42 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile?
The IUPAC name of 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile (CID 125469996) is 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile.
What is the SMILES notation for 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile?
The canonical SMILES for 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile is N#CC[C@H]1CCC[C@H](N)C1.
What is the InChIKey of 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile?
The InChIKey is LORJPTZKJDDDFO-SFYZADRCSA-N. The full InChI is InChI=1S/C8H14N2/c9-5-4-7-2-1-3-8(10)6-7/h7-8H,1-4,6,10H2/t7-,8+/m1/s1.
What are the key properties of 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile?
2-[(1S,3S)-3-aminocyclohexyl]acetonitrile has a molecular weight of 138.21 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile is sourced from PubChem (CID 125469996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).