C8H14N2 — CID 125469996
2-[(1S,3S)-3-aminocyclohexyl]acetonitrile (PubChem CID 125469996) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile.
| Compound Name | 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 125469996 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-[(1S,3S)-3-aminocyclohexyl]acetonitrile |
| SMILES | N#CC[C@H]1CCC[C@H](N)C1 |
| InChI | InChI=1S/C8H14N2/c9-5-4-7-2-1-3-8(10)6-7/h7-8H,1-4,6,10H2/t7-,8+/m1/s1 |
| InChIKey | LORJPTZKJDDDFO-SFYZADRCSA-N |
| XLogP | 1.42 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |