About 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate
10-(3-iminobutanoyloxy)decyl 3-iminobutanoate (PubChem CID 125470060) has the molecular formula C18H32N2O4
and a molecular weight of 340.46 g/mol. Its IUPAC name is 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate.
Molecular Properties
| Compound Name | 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate |
| PubChem CID | 125470060 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate |
| SMILES | [H]/N=C(\C)CC(=O)OCCCCCCCCCCOC(=O)C/C(C)=N/[H] |
| InChI | InChI=1S/C18H32N2O4/c1-15(19)13-17(21)23-11-9-7-5-3-4-6-8-10-12-24-18(22)14-16(2)20/h19-20H,3-14H2,1-2H3/b19-15+,20-16+ |
| InChIKey | HIIUYMLQSXSTSL-MXWIWYRXSA-N |
| XLogP | 4.05 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate?
The IUPAC name of 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate (CID 125470060) is 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate.
What is the SMILES notation for 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate?
The canonical SMILES for 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate is [H]/N=C(\C)CC(=O)OCCCCCCCCCCOC(=O)C/C(C)=N/[H].
What is the InChIKey of 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate?
The InChIKey is HIIUYMLQSXSTSL-MXWIWYRXSA-N. The full InChI is InChI=1S/C18H32N2O4/c1-15(19)13-17(21)23-11-9-7-5-3-4-6-8-10-12-24-18(22)14-16(2)20/h19-20H,3-14H2,1-2H3/b19-15+,20-16+.
What are the key properties of 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate?
10-(3-iminobutanoyloxy)decyl 3-iminobutanoate has a molecular weight of 340.46 g/mol, XLogP of 4.05, 15 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-iminobutanoyloxy)decyl 3-iminobutanoate is sourced from PubChem (CID 125470060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).