C13H17NO — CID 125470084
(NE)-N-[(2R)-2-phenylcycloheptylidene]hydroxylamine (PubChem CID 125470084) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (NE)-N-[(2R)-2-phenylcycloheptylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2R)-2-phenylcycloheptylidene]hydroxylamine |
|---|---|
| PubChem CID | 125470084 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (NE)-N-[(2R)-2-phenylcycloheptylidene]hydroxylamine |
| SMILES | O/N=C1\CCCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H17NO/c15-14-13-10-6-2-5-9-12(13)11-7-3-1-4-8-11/h1,3-4,7-8,12,15H,2,5-6,9-10H2/b14-13+/t12-/m1/s1 |
| InChIKey | OYAWGZAJTZOOHE-VEOJIXDASA-N |
| XLogP | 3.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|