C18H26N2O — CID 125470128
trans-(1R,2R)-N-phenyl-2-piperidin-1-ylcyclohexane-1-carboxamide (PubChem CID 125470128) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is trans-(1R,2R)-N-phenyl-2-piperidin-1-ylcyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-phenyl-2-piperidin-1-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 125470128 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | trans-(1R,2R)-N-phenyl-2-piperidin-1-ylcyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1CCCC[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C18H26N2O/c21-18(19-15-9-3-1-4-10-15)16-11-5-6-12-17(16)20-13-7-2-8-14-20/h1,3-4,9-10,16-17H,2,5-8,11-14H2,(H,19,21)/t16-,17-/m1/s1 |
| InChIKey | PDQOLVBFFZDUHW-IAGOWNOFSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |