C13H12ClF3O4 — CID 125470254
ethyl (2S)-2-(3-chloro-4-methylphenoxy)-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 125470254) has the molecular formula C13H12ClF3O4 and a molecular weight of 324.68 g/mol. Its IUPAC name is ethyl (2S)-2-(3-chloro-4-methylphenoxy)-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl (2S)-2-(3-chloro-4-methylphenoxy)-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 125470254 |
| Molecular Formula | C13H12ClF3O4 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | ethyl (2S)-2-(3-chloro-4-methylphenoxy)-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](Oc1ccc(C)c(Cl)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12ClF3O4/c1-3-20-12(19)10(11(18)13(15,16)17)21-8-5-4-7(2)9(14)6-8/h4-6,10H,3H2,1-2H3/t10-/m0/s1 |
| InChIKey | STLSEFOWLOAOMH-JTQLQIEISA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|