C14H17Cl2N — CID 125470701
(3aR,6aS)-3a-(3,5-dichlorophenyl)-2-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 125470701) has the molecular formula C14H17Cl2N and a molecular weight of 270.20 g/mol. Its IUPAC name is (3aR,6aS)-3a-(3,5-dichlorophenyl)-2-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-3a-(3,5-dichlorophenyl)-2-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 125470701 |
| Molecular Formula | C14H17Cl2N |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (3aR,6aS)-3a-(3,5-dichlorophenyl)-2-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | CN1C[C@H]2CCC[C@@]2(c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2N/c1-17-8-10-3-2-4-14(10,9-17)11-5-12(15)7-13(16)6-11/h5-7,10H,2-4,8-9H2,1H3/t10-,14-/m1/s1 |
| InChIKey | KXQVOLBRJCPHMW-QMTHXVAHSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |