About N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide
N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide (PubChem CID 125471102) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide |
| PubChem CID | 125471102 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide |
| SMILES | O=C(N[C@@]12CNC[C@H]1C2)C1CC1 |
| InChI | InChI=1S/C9H14N2O/c12-8(6-1-2-6)11-9-3-7(9)4-10-5-9/h6-7,10H,1-5H2,(H,11,12)/t7-,9+/m1/s1 |
| InChIKey | KUOIJWXCPPHTHN-APPZFPTMSA-N |
| XLogP | -0.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide?
The IUPAC name of N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide (CID 125471102) is N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide.
What is the SMILES notation for N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide?
The canonical SMILES for N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide is O=C(N[C@@]12CNC[C@H]1C2)C1CC1.
What is the InChIKey of N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide?
The InChIKey is KUOIJWXCPPHTHN-APPZFPTMSA-N. The full InChI is InChI=1S/C9H14N2O/c12-8(6-1-2-6)11-9-3-7(9)4-10-5-9/h6-7,10H,1-5H2,(H,11,12)/t7-,9+/m1/s1.
What are the key properties of N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide?
N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide has a molecular weight of 166.22 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]cyclopropanecarboxamide is sourced from PubChem (CID 125471102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).