About methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate
methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate (PubChem CID 125471253) has the molecular formula C16H14O4
and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate.
Molecular Properties
| Compound Name | methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate |
| PubChem CID | 125471253 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H](O)c1ccccc1OC2 |
| InChI | InChI=1S/C16H14O4/c1-19-16(18)10-6-7-11-9-20-14-5-3-2-4-12(14)15(17)13(11)8-10/h2-8,15,17H,9H2,1H3/t15-/m1/s1 |
| InChIKey | PLIFSVVEJVOWDD-OAHLLOKOSA-N |
| XLogP | 2.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate?
The IUPAC name of methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate (CID 125471253) is methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate.
What is the SMILES notation for methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate?
The canonical SMILES for methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate is COC(=O)c1ccc2c(c1)[C@H](O)c1ccccc1OC2.
What is the InChIKey of methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate?
The InChIKey is PLIFSVVEJVOWDD-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H14O4/c1-19-16(18)10-6-7-11-9-20-14-5-3-2-4-12(14)15(17)13(11)8-10/h2-8,15,17H,9H2,1H3/t15-/m1/s1.
What are the key properties of methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate?
methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate has a molecular weight of 270.28 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (11S)-11-hydroxy-6,11-dihydrobenzo[c][1]benzoxepine-9-carboxylate is sourced from PubChem (CID 125471253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).