About N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide
N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide (PubChem CID 125471376) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide |
| PubChem CID | 125471376 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide |
| SMILES | CN(C(=O)C1CC1)[C@H]1CC(=O)c2ccccc2C1 |
| InChI | InChI=1S/C15H17NO2/c1-16(15(18)10-6-7-10)12-8-11-4-2-3-5-13(11)14(17)9-12/h2-5,10,12H,6-9H2,1H3/t12-/m1/s1 |
| InChIKey | PITJUVHXHVTDQO-GFCCVEGCSA-N |
| XLogP | 2.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide?
The IUPAC name of N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide (CID 125471376) is N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide.
What is the SMILES notation for N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide?
The canonical SMILES for N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide is CN(C(=O)C1CC1)[C@H]1CC(=O)c2ccccc2C1.
What is the InChIKey of N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide?
The InChIKey is PITJUVHXHVTDQO-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H17NO2/c1-16(15(18)10-6-7-10)12-8-11-4-2-3-5-13(11)14(17)9-12/h2-5,10,12H,6-9H2,1H3/t12-/m1/s1.
What are the key properties of N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide?
N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide has a molecular weight of 243.31 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(2R)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]cyclopropanecarboxamide is sourced from PubChem (CID 125471376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).