C10H18N2 — CID 125471931
(3aR,6aS)-4,4,6,6-tetramethyl-1,3a,5,6a-tetrahydrocyclopenta[d]imidazole (PubChem CID 125471931) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3aR,6aS)-4,4,6,6-tetramethyl-1,3a,5,6a-tetrahydrocyclopenta[d]imidazole.
| Compound Name | (3aR,6aS)-4,4,6,6-tetramethyl-1,3a,5,6a-tetrahydrocyclopenta[d]imidazole |
|---|---|
| PubChem CID | 125471931 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3aR,6aS)-4,4,6,6-tetramethyl-1,3a,5,6a-tetrahydrocyclopenta[d]imidazole |
| SMILES | CC1(C)CC(C)(C)[C@H]2N=CN[C@H]21 |
| InChI | InChI=1S/C10H18N2/c1-9(2)5-10(3,4)8-7(9)11-6-12-8/h6-8H,5H2,1-4H3,(H,11,12)/t7-,8+ |
| InChIKey | HLBLNMSBBIVUTB-OCAPTIKFSA-N |
| XLogP | 1.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |