C10H12Cl2N2O2S — CID 125472288
ethyl (2S)-2-(4,6-dichloropyrimidin-2-yl)sulfanylbutanoate (PubChem CID 125472288) has the molecular formula C10H12Cl2N2O2S and a molecular weight of 295.19 g/mol. Its IUPAC name is ethyl (2S)-2-(4,6-dichloropyrimidin-2-yl)sulfanylbutanoate.
| Compound Name | ethyl (2S)-2-(4,6-dichloropyrimidin-2-yl)sulfanylbutanoate |
|---|---|
| PubChem CID | 125472288 |
| Molecular Formula | C10H12Cl2N2O2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | ethyl (2S)-2-(4,6-dichloropyrimidin-2-yl)sulfanylbutanoate |
| SMILES | CCOC(=O)[C@H](CC)Sc1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C10H12Cl2N2O2S/c1-3-6(9(15)16-4-2)17-10-13-7(11)5-8(12)14-10/h5-6H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | XHYYBDMVKXPUBF-LURJTMIESA-N |
| XLogP | 3.22 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |