About (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine
(2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine (PubChem CID 12547279) has the molecular formula C15H14FN
and a molecular weight of 227.28 g/mol. Its IUPAC name is (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine.
Molecular Properties
| Compound Name | (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine |
| PubChem CID | 12547279 |
| Molecular Formula | C15H14FN |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine |
| SMILES | C[C@@]1(c2ccccc2)[C@H](c2ccccc2)N1F |
| InChI | InChI=1S/C15H14FN/c1-15(13-10-6-3-7-11-13)14(17(15)16)12-8-4-2-5-9-12/h2-11,14H,1H3/t14-,15+,17?/m0/s1 |
| InChIKey | HSROQGZYYLFWRQ-BTPDTDQASA-N |
| XLogP | 3.84 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine?
The IUPAC name of (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine (CID 12547279) is (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine.
What is the SMILES notation for (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine?
The canonical SMILES for (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine is C[C@@]1(c2ccccc2)[C@H](c2ccccc2)N1F.
What is the InChIKey of (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine?
The InChIKey is HSROQGZYYLFWRQ-BTPDTDQASA-N. The full InChI is InChI=1S/C15H14FN/c1-15(13-10-6-3-7-11-13)14(17(15)16)12-8-4-2-5-9-12/h2-11,14H,1H3/t14-,15+,17?/m0/s1.
What are the key properties of (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine?
(2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine has a molecular weight of 227.28 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-1-fluoro-2-methyl-2,3-diphenylaziridine is sourced from PubChem (CID 12547279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).