About (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane
(2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane (PubChem CID 125472801) has the molecular formula C18H19BrO
and a molecular weight of 331.25 g/mol. Its IUPAC name is (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane.
Molecular Properties
| Compound Name | (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane |
| PubChem CID | 125472801 |
| Molecular Formula | C18H19BrO |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane |
| SMILES | C[C@@H]1O[C@@H](CBr)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19BrO/c1-14-18(12-17(13-19)20-14,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3/t14-,17+/m0/s1 |
| InChIKey | DABTWCBLGBLSDI-WMLDXEAASA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane?
The IUPAC name of (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane (CID 125472801) is (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane.
What is the SMILES notation for (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane?
The canonical SMILES for (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane is C[C@@H]1O[C@@H](CBr)CC1(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane?
The InChIKey is DABTWCBLGBLSDI-WMLDXEAASA-N. The full InChI is InChI=1S/C18H19BrO/c1-14-18(12-17(13-19)20-14,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3/t14-,17+/m0/s1.
What are the key properties of (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane?
(2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane has a molecular weight of 331.25 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-5-(bromomethyl)-2-methyl-3,3-diphenyloxolane is sourced from PubChem (CID 125472801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).