C12H26N2O3Si — CID 125472841
3-[(3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl]propan-1-amine (PubChem CID 125472841) has the molecular formula C12H26N2O3Si and a molecular weight of 274.44 g/mol. Its IUPAC name is 3-[(3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl]propan-1-amine.
| Compound Name | 3-[(3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 125472841 |
| Molecular Formula | C12H26N2O3Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-[(3R,7R,10R)-3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl]propan-1-amine |
| SMILES | C[C@@H]1CN2C[C@@H](C)O[Si](CCCN)(O1)O[C@H](C)C2 |
| InChI | InChI=1S/C12H26N2O3Si/c1-10-7-14-8-11(2)16-18(15-10,6-4-5-13)17-12(3)9-14/h10-12H,4-9,13H2,1-3H3/t10-,11-,12-/m1/s1 |
| InChIKey | HFDGSUROEHBOLK-IJLUTSLNSA-N |
| XLogP | 0.82 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|