C13H24O3 — CID 125472886
(3R,4aR,7aS)-3-(2-ethylbutyl)-3-methyl-4a,5,6,7a-tetrahydro-4H-furo[2,3-c][1,2]dioxine (PubChem CID 125472886) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (3R,4aR,7aS)-3-(2-ethylbutyl)-3-methyl-4a,5,6,7a-tetrahydro-4H-furo[2,3-c][1,2]dioxine.
| Compound Name | (3R,4aR,7aS)-3-(2-ethylbutyl)-3-methyl-4a,5,6,7a-tetrahydro-4H-furo[2,3-c][1,2]dioxine |
|---|---|
| PubChem CID | 125472886 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (3R,4aR,7aS)-3-(2-ethylbutyl)-3-methyl-4a,5,6,7a-tetrahydro-4H-furo[2,3-c][1,2]dioxine |
| SMILES | CCC(CC)C[C@]1(C)C[C@H]2CCO[C@H]2OO1 |
| InChI | InChI=1S/C13H24O3/c1-4-10(5-2)8-13(3)9-11-6-7-14-12(11)15-16-13/h10-12H,4-9H2,1-3H3/t11-,12+,13-/m1/s1 |
| InChIKey | MLJUSMDUIZKSGQ-FRRDWIJNSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|