C11H8F7NO2 — CID 125473083
ethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)pyridine-3-carboxylate (PubChem CID 125473083) has the molecular formula C11H8F7NO2 and a molecular weight of 319.18 g/mol. Its IUPAC name is ethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 125473083 |
| Molecular Formula | C11H8F7NO2 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | ethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(F)(F)C(F)(F)C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H8F7NO2/c1-2-21-8(20)6-3-4-7(19-5-6)9(12,13)10(14,15)11(16,17)18/h3-5H,2H2,1H3 |
| InChIKey | OAIGYRUBDFKAAL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|