C20H24ClNO3S — CID 125473241
2-[[(1R,2R)-1-(3-chlorophenyl)sulfanyl-1-phenoxybutan-2-yl]-ethylamino]acetic acid (PubChem CID 125473241) has the molecular formula C20H24ClNO3S and a molecular weight of 393.94 g/mol. Its IUPAC name is 2-[[(1R,2R)-1-(3-chlorophenyl)sulfanyl-1-phenoxybutan-2-yl]-ethylamino]acetic acid.
| Compound Name | 2-[[(1R,2R)-1-(3-chlorophenyl)sulfanyl-1-phenoxybutan-2-yl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 125473241 |
| Molecular Formula | C20H24ClNO3S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[[(1R,2R)-1-(3-chlorophenyl)sulfanyl-1-phenoxybutan-2-yl]-ethylamino]acetic acid |
| SMILES | CC[C@H]([C@H](Oc1ccccc1)Sc1cccc(Cl)c1)N(CC)CC(=O)O |
| InChI | InChI=1S/C20H24ClNO3S/c1-3-18(22(4-2)14-19(23)24)20(25-16-10-6-5-7-11-16)26-17-12-8-9-15(21)13-17/h5-13,18,20H,3-4,14H2,1-2H3,(H,23,24)/t18-,20-/m1/s1 |
| InChIKey | ZHZSSDXDWAQLGW-UYAOXDASSA-N |
| XLogP | 5.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|