C15H11ClFN3O — CID 125473452
N-(4-chloro-3-fluorophenyl)-2-imidazo[1,2-a]pyridin-5-ylacetamide (PubChem CID 125473452) has the molecular formula C15H11ClFN3O and a molecular weight of 303.72 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-2-imidazo[1,2-a]pyridin-5-ylacetamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-2-imidazo[1,2-a]pyridin-5-ylacetamide |
|---|---|
| PubChem CID | 125473452 |
| Molecular Formula | C15H11ClFN3O |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-2-imidazo[1,2-a]pyridin-5-ylacetamide |
| SMILES | O=C(Cc1cccc2nccn12)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H11ClFN3O/c16-12-5-4-10(8-13(12)17)19-15(21)9-11-2-1-3-14-18-6-7-20(11)14/h1-8H,9H2,(H,19,21) |
| InChIKey | BQNCBANJJMPVJU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |