C15H18N2OS — CID 125474081
(10aS)-2-phenyl-3-sulfanylidene-6,7,8,9,10,10a-hexahydro-5H-imidazo[1,5-a]azocin-1-one (PubChem CID 125474081) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is (10aS)-2-phenyl-3-sulfanylidene-6,7,8,9,10,10a-hexahydro-5H-imidazo[1,5-a]azocin-1-one.
| Compound Name | (10aS)-2-phenyl-3-sulfanylidene-6,7,8,9,10,10a-hexahydro-5H-imidazo[1,5-a]azocin-1-one |
|---|---|
| PubChem CID | 125474081 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (10aS)-2-phenyl-3-sulfanylidene-6,7,8,9,10,10a-hexahydro-5H-imidazo[1,5-a]azocin-1-one |
| SMILES | O=C1[C@@H]2CCCCCCN2C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C15H18N2OS/c18-14-13-10-6-1-2-7-11-16(13)15(19)17(14)12-8-4-3-5-9-12/h3-5,8-9,13H,1-2,6-7,10-11H2/t13-/m0/s1 |
| InChIKey | WVOVZDZYCXGOLH-ZDUSSCGKSA-N |
| XLogP | 2.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|