C19H28N2O2 — CID 125474268
[(1R,2R)-2-(4-methoxyanilino)cyclohexyl]-piperidin-1-ylmethanone (PubChem CID 125474268) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(1R,2R)-2-(4-methoxyanilino)cyclohexyl]-piperidin-1-ylmethanone.
| Compound Name | [(1R,2R)-2-(4-methoxyanilino)cyclohexyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 125474268 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(1R,2R)-2-(4-methoxyanilino)cyclohexyl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(N[C@@H]2CCCC[C@H]2C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-23-16-11-9-15(10-12-16)20-18-8-4-3-7-17(18)19(22)21-13-5-2-6-14-21/h9-12,17-18,20H,2-8,13-14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | RNRFPCCSPSLMPE-QZTJIDSGSA-N |
| XLogP | 3.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|