About methyl 4,4-dimethyl-3,5-dioxohexanoate
methyl 4,4-dimethyl-3,5-dioxohexanoate (PubChem CID 125474437) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 4,4-dimethyl-3,5-dioxohexanoate.
Molecular Properties
| Compound Name | methyl 4,4-dimethyl-3,5-dioxohexanoate |
| PubChem CID | 125474437 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl 4,4-dimethyl-3,5-dioxohexanoate |
| SMILES | COC(=O)CC(=O)C(C)(C)C(C)=O |
| InChI | InChI=1S/C9H14O4/c1-6(10)9(2,3)7(11)5-8(12)13-4/h5H2,1-4H3 |
| InChIKey | AOYPJZAJSAPYOU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 4,4-dimethyl-3,5-dioxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,4-dimethyl-3,5-dioxohexanoate?
The IUPAC name of methyl 4,4-dimethyl-3,5-dioxohexanoate (CID 125474437) is methyl 4,4-dimethyl-3,5-dioxohexanoate.
What is the SMILES notation for methyl 4,4-dimethyl-3,5-dioxohexanoate?
The canonical SMILES for methyl 4,4-dimethyl-3,5-dioxohexanoate is COC(=O)CC(=O)C(C)(C)C(C)=O.
What is the InChIKey of methyl 4,4-dimethyl-3,5-dioxohexanoate?
The InChIKey is AOYPJZAJSAPYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-6(10)9(2,3)7(11)5-8(12)13-4/h5H2,1-4H3.
What are the key properties of methyl 4,4-dimethyl-3,5-dioxohexanoate?
methyl 4,4-dimethyl-3,5-dioxohexanoate has a molecular weight of 186.21 g/mol, XLogP of 0.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,4-dimethyl-3,5-dioxohexanoate is sourced from PubChem (CID 125474437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).