C12H8F6N2O — CID 125475269
[1-[2,4-bis(trifluoromethyl)phenyl]imidazol-4-yl]methanol (PubChem CID 125475269) has the molecular formula C12H8F6N2O and a molecular weight of 310.20 g/mol. Its IUPAC name is [1-[2,4-bis(trifluoromethyl)phenyl]imidazol-4-yl]methanol.
| Compound Name | [1-[2,4-bis(trifluoromethyl)phenyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 125475269 |
| Molecular Formula | C12H8F6N2O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [1-[2,4-bis(trifluoromethyl)phenyl]imidazol-4-yl]methanol |
| SMILES | OCc1cn(-c2ccc(C(F)(F)F)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H8F6N2O/c13-11(14,15)7-1-2-10(9(3-7)12(16,17)18)20-4-8(5-21)19-6-20/h1-4,6,21H,5H2 |
| InChIKey | ZVMUDBXSDOFRJC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |