C8H10BrClO2 — CID 125475507
[(1S,2R)-2-bromo-3-chlorocyclohex-3-en-1-yl] acetate (PubChem CID 125475507) has the molecular formula C8H10BrClO2 and a molecular weight of 253.52 g/mol. Its IUPAC name is [(1S,2R)-2-bromo-3-chlorocyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2R)-2-bromo-3-chlorocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 125475507 |
| Molecular Formula | C8H10BrClO2 |
| Molecular Weight | 253.52 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | [(1S,2R)-2-bromo-3-chlorocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC=C(Cl)[C@@H]1Br |
| InChI | InChI=1S/C8H10BrClO2/c1-5(11)12-7-4-2-3-6(10)8(7)9/h3,7-8H,2,4H2,1H3/t7-,8-/m0/s1 |
| InChIKey | FKLAZRSECZARQP-YUMQZZPRSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|