C9H14O3 — CID 125475561
methyl (E,2R)-2-methyl-6-oxohept-4-enoate (PubChem CID 125475561) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl (E,2R)-2-methyl-6-oxohept-4-enoate.
| Compound Name | methyl (E,2R)-2-methyl-6-oxohept-4-enoate |
|---|---|
| PubChem CID | 125475561 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | methyl (E,2R)-2-methyl-6-oxohept-4-enoate |
| SMILES | COC(=O)[C@H](C)C/C=C/C(C)=O |
| InChI | InChI=1S/C9H14O3/c1-7(9(11)12-3)5-4-6-8(2)10/h4,6-7H,5H2,1-3H3/b6-4+/t7-/m1/s1 |
| InChIKey | UFJLHZMNOAILHA-PTYLAXBQSA-N |
| XLogP | 1.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|