C10H14O2 — CID 125475617
(2R,3S,6R)-3-ethyl-2-ethynyl-6-methoxy-3,6-dihydro-2H-pyran (PubChem CID 125475617) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2R,3S,6R)-3-ethyl-2-ethynyl-6-methoxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6R)-3-ethyl-2-ethynyl-6-methoxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 125475617 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2R,3S,6R)-3-ethyl-2-ethynyl-6-methoxy-3,6-dihydro-2H-pyran |
| SMILES | C#C[C@@H]1O[C@@H](OC)C=C[C@@H]1CC |
| InChI | InChI=1S/C10H14O2/c1-4-8-6-7-10(11-3)12-9(8)5-2/h2,6-10H,4H2,1,3H3/t8-,9-,10+/m0/s1 |
| InChIKey | MIVMIHIDOLGMIA-LPEHRKFASA-N |
| XLogP | 1.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|