2,3,3-trimethylbutanoyl chloride

C7H13ClO — CID 12547645

IUPAC2,3,3-trimethylbutanoyl chloride
SMILESCC(C(=O)Cl)C(C)(C)C
InChIInChI=1S/C7H13ClO/c1-5(6(8)9)7(2,3)4/h5H,1-4H3
InChIKeySXJYIEBMAQEWPK-UHFFFAOYSA-N
MW148.63 g/mol
LogP2.43
Rot. Bonds1

About 2,3,3-trimethylbutanoyl chloride

2,3,3-trimethylbutanoyl chloride (PubChem CID 12547645) has the molecular formula C7H13ClO and a molecular weight of 148.63 g/mol. Its IUPAC name is 2,3,3-trimethylbutanoyl chloride.

Molecular Properties

Compound Name2,3,3-trimethylbutanoyl chloride
PubChem CID12547645
Molecular FormulaC7H13ClO
Molecular Weight148.63 g/mol
Exact Mass148.07
IUPAC Name2,3,3-trimethylbutanoyl chloride
SMILESCC(C(=O)Cl)C(C)(C)C
InChIInChI=1S/C7H13ClO/c1-5(6(8)9)7(2,3)4/h5H,1-4H3
InChIKeySXJYIEBMAQEWPK-UHFFFAOYSA-N
XLogP2.43
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.63
LogP ≤ 52.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,3,3-trimethylbutanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,3-trimethylbutanoyl chloride?
The IUPAC name of 2,3,3-trimethylbutanoyl chloride (CID 12547645) is 2,3,3-trimethylbutanoyl chloride.
What is the SMILES notation for 2,3,3-trimethylbutanoyl chloride?
The canonical SMILES for 2,3,3-trimethylbutanoyl chloride is CC(C(=O)Cl)C(C)(C)C.
What is the InChIKey of 2,3,3-trimethylbutanoyl chloride?
The InChIKey is SXJYIEBMAQEWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO/c1-5(6(8)9)7(2,3)4/h5H,1-4H3.
What are the key properties of 2,3,3-trimethylbutanoyl chloride?
2,3,3-trimethylbutanoyl chloride has a molecular weight of 148.63 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-trimethylbutanoyl chloride is sourced from PubChem (CID 12547645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).