About 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one
5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one (PubChem CID 125476597) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one.
Molecular Properties
| Compound Name | 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one |
| PubChem CID | 125476597 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one |
| SMILES | C/C=C/COc1cccc2c1C(=O)C2 |
| InChI | InChI=1S/C12H12O2/c1-2-3-7-14-11-6-4-5-9-8-10(13)12(9)11/h2-6H,7-8H2,1H3/b3-2+ |
| InChIKey | PMDWNKDEZWHHRR-NSCUHMNNSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
The IUPAC name of 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one (CID 125476597) is 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one.
What is the SMILES notation for 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
The canonical SMILES for 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one is C/C=C/COc1cccc2c1C(=O)C2.
What is the InChIKey of 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
The InChIKey is PMDWNKDEZWHHRR-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-3-7-14-11-6-4-5-9-8-10(13)12(9)11/h2-6H,7-8H2,1H3/b3-2+.
What are the key properties of 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one has a molecular weight of 188.23 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-but-2-enoxy]bicyclo[4.2.0]octa-1(6),2,4-trien-7-one is sourced from PubChem (CID 125476597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).