C10H16O2 — CID 125476612
(8E)-8-methyl-2,3,5,6,7,10-hexahydrooxecin-4-one (PubChem CID 125476612) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (8E)-8-methyl-2,3,5,6,7,10-hexahydrooxecin-4-one.
| Compound Name | (8E)-8-methyl-2,3,5,6,7,10-hexahydrooxecin-4-one |
|---|---|
| PubChem CID | 125476612 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (8E)-8-methyl-2,3,5,6,7,10-hexahydrooxecin-4-one |
| SMILES | C/C1=C\COCCC(=O)CCC1 |
| InChI | InChI=1S/C10H16O2/c1-9-3-2-4-10(11)6-8-12-7-5-9/h5H,2-4,6-8H2,1H3/b9-5+ |
| InChIKey | QUWVTMVJFOXBJT-WEVVVXLNSA-N |
| XLogP | 2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|