C11H11BrO2 — CID 125477011
(4R)-4-(3-bromophenyl)-4-ethenyl-1,3-dioxolane (PubChem CID 125477011) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is (4R)-4-(3-bromophenyl)-4-ethenyl-1,3-dioxolane.
| Compound Name | (4R)-4-(3-bromophenyl)-4-ethenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 125477011 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | (4R)-4-(3-bromophenyl)-4-ethenyl-1,3-dioxolane |
| SMILES | C=C[C@@]1(c2cccc(Br)c2)COCO1 |
| InChI | InChI=1S/C11H11BrO2/c1-2-11(7-13-8-14-11)9-4-3-5-10(12)6-9/h2-6H,1,7-8H2/t11-/m0/s1 |
| InChIKey | YDEODIGWTPJEGR-NSHDSACASA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|