C11H5ClF9NOS — CID 125477343
(S)-N-[(4-chlorophenyl)methylidene]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide (PubChem CID 125477343) has the molecular formula C11H5ClF9NOS and a molecular weight of 405.67 g/mol. Its IUPAC name is (S)-N-[(4-chlorophenyl)methylidene]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide.
| Compound Name | (S)-N-[(4-chlorophenyl)methylidene]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
|---|---|
| PubChem CID | 125477343 |
| Molecular Formula | C11H5ClF9NOS |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | (S)-N-[(4-chlorophenyl)methylidene]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
| SMILES | O=[S@](N=Cc1ccc(Cl)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5ClF9NOS/c12-7-3-1-6(2-4-7)5-22-24(23)11(20,21)9(15,16)8(13,14)10(17,18)19/h1-5H/t24-/m0/s1 |
| InChIKey | MGQRMTIVHOQHJI-DEOSSOPVSA-N |
| XLogP | 4.85 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|