About 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene
1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene (PubChem CID 125477421) has the molecular formula C11H9Br2F
and a molecular weight of 320.00 g/mol. Its IUPAC name is 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene.
Molecular Properties
| Compound Name | 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene |
| PubChem CID | 125477421 |
| Molecular Formula | C11H9Br2F |
| Molecular Weight | 320.00 g/mol |
| Exact Mass | 317.91 |
| IUPAC Name | 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene |
| SMILES | C=CC/C(Br)=C(/Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H9Br2F/c1-2-3-10(12)11(13)8-4-6-9(14)7-5-8/h2,4-7H,1,3H2/b11-10- |
| InChIKey | RNDGXLKFJURNCG-KHPPLWFESA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene?
The IUPAC name of 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene (CID 125477421) is 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene.
What is the SMILES notation for 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene?
The canonical SMILES for 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene is C=CC/C(Br)=C(/Br)c1ccc(F)cc1.
What is the InChIKey of 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene?
The InChIKey is RNDGXLKFJURNCG-KHPPLWFESA-N. The full InChI is InChI=1S/C11H9Br2F/c1-2-3-10(12)11(13)8-4-6-9(14)7-5-8/h2,4-7H,1,3H2/b11-10-.
What are the key properties of 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene?
1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene has a molecular weight of 320.00 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z)-1,2-dibromopenta-1,4-dienyl]-4-fluorobenzene is sourced from PubChem (CID 125477421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).