C11H8FNOS2 — CID 125477626
(5Z)-5-[(3-fluorophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one (PubChem CID 125477626) has the molecular formula C11H8FNOS2 and a molecular weight of 253.32 g/mol. Its IUPAC name is (5Z)-5-[(3-fluorophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(3-fluorophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 125477626 |
| Molecular Formula | C11H8FNOS2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | (5Z)-5-[(3-fluorophenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
| SMILES | CSC1=NC(=O)/C(=C/c2cccc(F)c2)S1 |
| InChI | InChI=1S/C11H8FNOS2/c1-15-11-13-10(14)9(16-11)6-7-3-2-4-8(12)5-7/h2-6H,1H3/b9-6- |
| InChIKey | KUPGTYNEMBEYDJ-TWGQIWQCSA-N |
| XLogP | 3.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|