C12H6F8 — CID 125477686
1-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]-4-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene (PubChem CID 125477686) has the molecular formula C12H6F8 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]-4-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene.
| Compound Name | 1-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]-4-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 125477686 |
| Molecular Formula | C12H6F8 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-[(Z)-2,3,3,3-tetrafluoroprop-1-enyl]-4-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene |
| SMILES | F/C(=C\c1ccc(/C=C(/F)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H6F8/c13-9(11(15,16)17)5-7-1-2-8(4-3-7)6-10(14)12(18,19)20/h1-6H/b9-5-,10-6+ |
| InChIKey | NIYJXZKEKUBVSZ-VTBWALSUSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |