C14H9N3OS — CID 125477911
5-sulfanylidene-1,8,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,8,10,14(17),15-hexaen-12-one (PubChem CID 125477911) has the molecular formula C14H9N3OS and a molecular weight of 267.31 g/mol. Its IUPAC name is 5-sulfanylidene-1,8,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,8,10,14(17),15-hexaen-12-one.
| Compound Name | 5-sulfanylidene-1,8,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,8,10,14(17),15-hexaen-12-one |
|---|---|
| PubChem CID | 125477911 |
| Molecular Formula | C14H9N3OS |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-sulfanylidene-1,8,15-triazatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,8,10,14(17),15-hexaen-12-one |
| SMILES | O=C1C=C2C=NC3=C(C=CC(=S)C3)n3cnc(c32)C1 |
| InChI | InChI=1S/C14H9N3OS/c18-9-3-8-6-15-11-5-10(19)1-2-13(11)17-7-16-12(4-9)14(8)17/h1-3,6-7H,4-5H2 |
| InChIKey | IMPSNXQMGXBGIN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|