C16H26N2O4 — CID 125478671
1-N,1-N'-bis(2,2-dimethylpropanoyl)cyclobutane-1,1-dicarboxamide (PubChem CID 125478671) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-N,1-N'-bis(2,2-dimethylpropanoyl)cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis(2,2-dimethylpropanoyl)cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 125478671 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-N,1-N'-bis(2,2-dimethylpropanoyl)cyclobutane-1,1-dicarboxamide |
| SMILES | CC(C)(C)C(=O)NC(=O)C1(C(=O)NC(=O)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C16H26N2O4/c1-14(2,3)10(19)17-12(21)16(8-7-9-16)13(22)18-11(20)15(4,5)6/h7-9H2,1-6H3,(H,17,19,21)(H,18,20,22) |
| InChIKey | AGKMFODZZNMVNA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|