About (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol
(2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol (PubChem CID 125479425) has the molecular formula C20H19NO2
and a molecular weight of 305.38 g/mol. Its IUPAC name is (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol |
| PubChem CID | 125479425 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol |
| SMILES | OC[C@@H](O)CNCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C20H19NO2/c22-12-17(23)11-21-10-16-7-6-15-5-4-13-2-1-3-14-8-9-18(16)20(15)19(13)14/h1-9,17,21-23H,10-12H2/t17-/m0/s1 |
| InChIKey | RRROFOSTWMHDMA-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol?
The IUPAC name of (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol (CID 125479425) is (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol.
What is the SMILES notation for (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol?
The canonical SMILES for (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol is OC[C@@H](O)CNCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol?
The InChIKey is RRROFOSTWMHDMA-KRWDZBQOSA-N. The full InChI is InChI=1S/C20H19NO2/c22-12-17(23)11-21-10-16-7-6-15-5-4-13-2-1-3-14-8-9-18(16)20(15)19(13)14/h1-9,17,21-23H,10-12H2/t17-/m0/s1.
What are the key properties of (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol?
(2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol has a molecular weight of 305.38 g/mol, XLogP of 3.03, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(pyren-1-ylmethylamino)propane-1,2-diol is sourced from PubChem (CID 125479425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).