C17H21NO2 — CID 125479500
5,5-dimethyl-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]cyclohexane-1,3-dione (PubChem CID 125479500) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 125479500 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 5,5-dimethyl-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]cyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C([C@H]2NCCc3ccccc32)C(=O)C1 |
| InChI | InChI=1S/C17H21NO2/c1-17(2)9-13(19)15(14(20)10-17)16-12-6-4-3-5-11(12)7-8-18-16/h3-6,15-16,18H,7-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | DEJOZQOFDYXLAP-INIZCTEOSA-N |
| XLogP | 2.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|